About [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine
[3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine (PubChem CID 118086233) has the molecular formula C14H15F6NO
and a molecular weight of 327.27 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine.
Molecular Properties
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine |
| PubChem CID | 118086233 |
| Molecular Formula | C14H15F6NO |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine |
| SMILES | NC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCOCC1 |
| InChI | InChI=1S/C14H15F6NO/c15-13(16,17)10-5-9(6-11(7-10)14(18,19)20)12(21)8-1-3-22-4-2-8/h5-8,12H,1-4,21H2 |
| InChIKey | VRNQAXRYKLUANB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine?
The IUPAC name of [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine (CID 118086233) is [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine.
What is the SMILES notation for [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine?
The canonical SMILES for [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine is NC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCOCC1.
What is the InChIKey of [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine?
The InChIKey is VRNQAXRYKLUANB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F6NO/c15-13(16,17)10-5-9(6-11(7-10)14(18,19)20)12(21)8-1-3-22-4-2-8/h5-8,12H,1-4,21H2.
What are the key properties of [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine?
[3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine has a molecular weight of 327.27 g/mol, XLogP of 4.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine is sourced from PubChem (CID 118086233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).