C38H57BrO7 — CID 118086842
(4S,6R)-2-[4-bromo-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-ol (PubChem CID 118086842) has the molecular formula C38H57BrO7 and a molecular weight of 705.77 g/mol. Its IUPAC name is (4S,6R)-2-[4-bromo-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-ol.
| Compound Name | (4S,6R)-2-[4-bromo-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 118086842 |
| Molecular Formula | C38H57BrO7 |
| Molecular Weight | 705.77 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | (4S,6R)-2-[4-bromo-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-ol |
| SMILES | CCCCOC[C@H]1OC(O)(c2ccc(Br)c(Cc3ccc4c(c3)CCCO4)c2)C(OCCCC)[C@@H](OCCCC)C1OCCCC |
| InChI | InChI=1S/C38H57BrO7/c1-5-9-19-41-27-34-35(43-20-10-6-2)36(44-21-11-7-3)37(45-22-12-8-4)38(40,46-34)31-16-17-32(39)30(26-31)25-28-15-18-33-29(24-28)14-13-23-42-33/h15-18,24,26,34-37,40H,5-14,19-23,25,27H2,1-4H3/t34-,35?,36+,37?,38?/m1/s1 |
| InChIKey | RKDYDMZCSQJFNZ-AZMQLRIISA-N |
| XLogP | 8.28 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.77 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|