C12H13F4NO — CID 118087119
2,2,2-trifluoro-1-[3-[(3Z,5Z)-3-fluorohepta-3,5-dienylidene]azetidin-1-yl]ethanone (PubChem CID 118087119) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[3-[(3Z,5Z)-3-fluorohepta-3,5-dienylidene]azetidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[3-[(3Z,5Z)-3-fluorohepta-3,5-dienylidene]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 118087119 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2,2,2-trifluoro-1-[3-[(3Z,5Z)-3-fluorohepta-3,5-dienylidene]azetidin-1-yl]ethanone |
| SMILES | C/C=C\C=C(/F)CC=C1CN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H13F4NO/c1-2-3-4-10(13)6-5-9-7-17(8-9)11(18)12(14,15)16/h2-5H,6-8H2,1H3/b3-2-,10-4- |
| InChIKey | XUBVMBAAPKYYNY-AHYMPWADSA-N |
| XLogP | 3.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|