About 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one
8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one (PubChem CID 118087429) has the molecular formula C22H13F3N4O
and a molecular weight of 406.37 g/mol. Its IUPAC name is 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one.
Molecular Properties
| Compound Name | 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one |
| PubChem CID | 118087429 |
| Molecular Formula | C22H13F3N4O |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one |
| SMILES | O=c1[nH]c2cnc3ccc(-c4ccncc4)cc3c2n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H13F3N4O/c23-22(24,25)15-2-1-3-16(11-15)29-20-17-10-14(13-6-8-26-9-7-13)4-5-18(17)27-12-19(20)28-21(29)30/h1-12H,(H,28,30) |
| InChIKey | ZNALUDBWRLTNLI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one?
The IUPAC name of 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one (CID 118087429) is 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one.
What is the SMILES notation for 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one?
The canonical SMILES for 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one is O=c1[nH]c2cnc3ccc(-c4ccncc4)cc3c2n1-c1cccc(C(F)(F)F)c1.
What is the InChIKey of 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one?
The InChIKey is ZNALUDBWRLTNLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13F3N4O/c23-22(24,25)15-2-1-3-16(11-15)29-20-17-10-14(13-6-8-26-9-7-13)4-5-18(17)27-12-19(20)28-21(29)30/h1-12H,(H,28,30).
What are the key properties of 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one?
8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one has a molecular weight of 406.37 g/mol, XLogP of 4.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pyridin-4-yl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one is sourced from PubChem (CID 118087429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).