C59H43N3 — CID 118088219
2-(9,9-dimethylfluoren-2-yl)-4-(9,10-dimethylphenanthren-2-yl)-6-(9,9-diphenylfluoren-2-yl)-1,3,5-triazine (PubChem CID 118088219) has the molecular formula C59H43N3 and a molecular weight of 794.01 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-2-yl)-4-(9,10-dimethylphenanthren-2-yl)-6-(9,9-diphenylfluoren-2-yl)-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-2-yl)-4-(9,10-dimethylphenanthren-2-yl)-6-(9,9-diphenylfluoren-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118088219 |
| Molecular Formula | C59H43N3 |
| Molecular Weight | 794.01 g/mol |
| Exact Mass | 793.35 |
| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-4-(9,10-dimethylphenanthren-2-yl)-6-(9,9-diphenylfluoren-2-yl)-1,3,5-triazine |
| SMILES | Cc1c(C)c2cc(-c3nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)nc(-c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4-5)n3)ccc2c2ccccc12 |
| InChI | InChI=1S/C59H43N3/c1-36-37(2)50-33-38(27-30-45(50)44-22-12-11-21-43(36)44)55-60-56(39-28-31-48-46-23-13-15-25-51(46)58(3,4)53(48)34-39)62-57(61-55)40-29-32-49-47-24-14-16-26-52(47)59(54(49)35-40,41-17-7-5-8-18-41)42-19-9-6-10-20-42/h5-35H,1-4H3 |
| InChIKey | AEBIHXJOCQTGAF-UHFFFAOYSA-N |
| XLogP | 14.47 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.01 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|