C19H26O3 — CID 11808829
(4aR,10aS)-6-hydroxy-5-methoxy-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one (PubChem CID 11808829) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (4aR,10aS)-6-hydroxy-5-methoxy-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one.
| Compound Name | (4aR,10aS)-6-hydroxy-5-methoxy-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 11808829 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (4aR,10aS)-6-hydroxy-5-methoxy-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
| SMILES | COc1c(O)c(C)cc2c1[C@]1(C)CCC(=O)C(C)(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H26O3/c1-11-10-12-6-7-13-18(2,3)14(20)8-9-19(13,4)15(12)17(22-5)16(11)21/h10,13,21H,6-9H2,1-5H3/t13-,19-/m1/s1 |
| InChIKey | PHJCGJMENDFPKF-BFUOFWGJSA-N |
| XLogP | 3.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |