C13H18N2 — CID 118088323
(3Z,5Z,8E,10Z)-12-imino-8-methyldodeca-1,3,5,8,10-pentaen-6-amine (PubChem CID 118088323) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (3Z,5Z,8E,10Z)-12-imino-8-methyldodeca-1,3,5,8,10-pentaen-6-amine.
| Compound Name | (3Z,5Z,8E,10Z)-12-imino-8-methyldodeca-1,3,5,8,10-pentaen-6-amine |
|---|---|
| PubChem CID | 118088323 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (3Z,5Z,8E,10Z)-12-imino-8-methyldodeca-1,3,5,8,10-pentaen-6-amine |
| SMILES | [H]/N=C/C=C\C=C(/C)C/C(N)=C/C=C\C=C |
| InChI | InChI=1S/C13H18N2/c1-3-4-5-9-13(15)11-12(2)8-6-7-10-14/h3-10,14H,1,11,15H2,2H3/b5-4-,7-6-,12-8+,13-9-,14-10+ |
| InChIKey | BKMPVGOTQSHPRY-UTVSLKTRSA-N |
| XLogP | 3.11 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|