C24H33FN2O6 — CID 118088748
(2S,3S)-3-cyclohexyl-2-[[4-(3-ethoxypropoxycarbonyl)-3-fluorophenyl]carbamoyl]pyrrolidine-1-carboxylic acid (PubChem CID 118088748) has the molecular formula C24H33FN2O6 and a molecular weight of 464.53 g/mol. Its IUPAC name is (2S,3S)-3-cyclohexyl-2-[[4-(3-ethoxypropoxycarbonyl)-3-fluorophenyl]carbamoyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2S,3S)-3-cyclohexyl-2-[[4-(3-ethoxypropoxycarbonyl)-3-fluorophenyl]carbamoyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 118088748 |
| Molecular Formula | C24H33FN2O6 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (2S,3S)-3-cyclohexyl-2-[[4-(3-ethoxypropoxycarbonyl)-3-fluorophenyl]carbamoyl]pyrrolidine-1-carboxylic acid |
| SMILES | CCOCCCOC(=O)c1ccc(NC(=O)[C@@H]2[C@H](C3CCCCC3)CCN2C(=O)O)cc1F |
| InChI | InChI=1S/C24H33FN2O6/c1-2-32-13-6-14-33-23(29)19-10-9-17(15-20(19)25)26-22(28)21-18(11-12-27(21)24(30)31)16-7-4-3-5-8-16/h9-10,15-16,18,21H,2-8,11-14H2,1H3,(H,26,28)(H,30,31)/t18-,21-/m0/s1 |
| InChIKey | NHAMZNVKSILCAK-RXVVDRJESA-N |
| XLogP | 4.30 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|