C34H44F6N4O6 — CID 118089198
(2S,3S)-1-[4-(1-aminopropyl)cyclohexanecarbonyl]-3-cyclohexyl-N-quinolin-6-ylpyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118089198) has the molecular formula C34H44F6N4O6 and a molecular weight of 718.74 g/mol. Its IUPAC name is (2S,3S)-1-[4-(1-aminopropyl)cyclohexanecarbonyl]-3-cyclohexyl-N-quinolin-6-ylpyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2S,3S)-1-[4-(1-aminopropyl)cyclohexanecarbonyl]-3-cyclohexyl-N-quinolin-6-ylpyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118089198 |
| Molecular Formula | C34H44F6N4O6 |
| Molecular Weight | 718.74 g/mol |
| Exact Mass | 718.32 |
| IUPAC Name | (2S,3S)-1-[4-(1-aminopropyl)cyclohexanecarbonyl]-3-cyclohexyl-N-quinolin-6-ylpyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCC(N)C1CCC(C(=O)N2CC[C@@H](C3CCCCC3)[C@H]2C(=O)Nc2ccc3ncccc3c2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H42N4O2.2C2HF3O2/c1-2-26(31)21-10-12-22(13-11-21)30(36)34-18-16-25(20-7-4-3-5-8-20)28(34)29(35)33-24-14-15-27-23(19-24)9-6-17-32-27;2*3-2(4,5)1(6)7/h6,9,14-15,17,19-22,25-26,28H,2-5,7-8,10-13,16,18,31H2,1H3,(H,33,35);2*(H,6,7)/t21?,22?,25-,26?,28-;;/m0../s1 |
| InChIKey | SJNDTQCNYZLVDU-ZIINKOATSA-N |
| XLogP | 6.78 |
| TPSA | 162.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.74 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |