C21H16FN3O5S3 — CID 118089226
(5E)-5-[[7-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 118089226) has the molecular formula C21H16FN3O5S3 and a molecular weight of 505.57 g/mol. Its IUPAC name is (5E)-5-[[7-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[7-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118089226 |
| Molecular Formula | C21H16FN3O5S3 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | (5E)-5-[[7-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C/c1cc2cncc(-c3ccc(S(=O)(=O)N4CCOCC4)c(F)c3)c2o1 |
| InChI | InChI=1S/C21H16FN3O5S3/c22-16-8-12(1-2-18(16)33(27,28)25-3-5-29-6-4-25)15-11-23-10-13-7-14(30-19(13)15)9-17-20(26)24-21(31)32-17/h1-2,7-11H,3-6H2,(H,24,26,31)/b17-9+ |
| InChIKey | XPSHZSXNXNQHAX-RQZCQDPDSA-N |
| XLogP | 3.14 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|