C19H9FN2O2S2 — CID 118089496
(5Z)-5-[[7-[2-(4-fluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 118089496) has the molecular formula C19H9FN2O2S2 and a molecular weight of 380.43 g/mol. Its IUPAC name is (5Z)-5-[[7-[2-(4-fluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[7-[2-(4-fluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118089496 |
| Molecular Formula | C19H9FN2O2S2 |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | (5Z)-5-[[7-[2-(4-fluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1cc2cncc(C#Cc3ccc(F)cc3)c2o1 |
| InChI | InChI=1S/C19H9FN2O2S2/c20-14-5-2-11(3-6-14)1-4-12-9-21-10-13-7-15(24-17(12)13)8-16-18(23)22-19(25)26-16/h2-3,5-10H,(H,22,23,25)/b16-8- |
| InChIKey | JMGYVSWCOMZNAW-PXNMLYILSA-N |
| XLogP | 3.86 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|