C20H9F3N2O3S2 — CID 118089536
(5Z)-2-sulfanylidene-5-[[7-[2-[2-(trifluoromethoxy)phenyl]ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 118089536) has the molecular formula C20H9F3N2O3S2 and a molecular weight of 446.43 g/mol. Its IUPAC name is (5Z)-2-sulfanylidene-5-[[7-[2-[2-(trifluoromethoxy)phenyl]ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-sulfanylidene-5-[[7-[2-[2-(trifluoromethoxy)phenyl]ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118089536 |
| Molecular Formula | C20H9F3N2O3S2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | (5Z)-2-sulfanylidene-5-[[7-[2-[2-(trifluoromethoxy)phenyl]ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1cc2cncc(C#Cc3ccccc3OC(F)(F)F)c2o1 |
| InChI | InChI=1S/C20H9F3N2O3S2/c21-20(22,23)28-15-4-2-1-3-11(15)5-6-12-9-24-10-13-7-14(27-17(12)13)8-16-18(26)25-19(29)30-16/h1-4,7-10H,(H,25,26,29)/b16-8- |
| InChIKey | ZLEQFCVUQRYOFB-PXNMLYILSA-N |
| XLogP | 4.61 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|