C18H8ClF3N2O3S — CID 118089540
(5Z)-5-[[7-[4-chloro-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118089540) has the molecular formula C18H8ClF3N2O3S and a molecular weight of 424.79 g/mol. Its IUPAC name is (5Z)-5-[[7-[4-chloro-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[7-[4-chloro-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118089540 |
| Molecular Formula | C18H8ClF3N2O3S |
| Molecular Weight | 424.79 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | (5Z)-5-[[7-[4-chloro-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc3cncc(-c4ccc(Cl)c(C(F)(F)F)c4)c3o2)S1 |
| InChI | InChI=1S/C18H8ClF3N2O3S/c19-13-2-1-8(4-12(13)18(20,21)22)11-7-23-6-9-3-10(27-15(9)11)5-14-16(25)24-17(26)28-14/h1-7H,(H,24,25,26)/b14-5- |
| InChIKey | YAGINFYCKRSIDH-RZNTYIFUSA-N |
| XLogP | 5.49 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.79 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|