C20H9F3N2O3S — CID 118089623
(5E)-5-[[7-[2-[4-(trifluoromethyl)phenyl]ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118089623) has the molecular formula C20H9F3N2O3S and a molecular weight of 414.36 g/mol. Its IUPAC name is (5E)-5-[[7-[2-[4-(trifluoromethyl)phenyl]ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[7-[2-[4-(trifluoromethyl)phenyl]ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118089623 |
| Molecular Formula | C20H9F3N2O3S |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | (5E)-5-[[7-[2-[4-(trifluoromethyl)phenyl]ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cc3cncc(C#Cc4ccc(C(F)(F)F)cc4)c3o2)S1 |
| InChI | InChI=1S/C20H9F3N2O3S/c21-20(22,23)14-5-2-11(3-6-14)1-4-12-9-24-10-13-7-15(28-17(12)13)8-16-18(26)25-19(27)29-16/h2-3,5-10H,(H,25,26,27)/b16-8+ |
| InChIKey | FHDNNKXOXPBWFJ-LZYBPNLTSA-N |
| XLogP | 4.57 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|