C17H10FN3O2S2 — CID 118089632
(5E)-5-[[7-(3-amino-4-fluorophenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 118089632) has the molecular formula C17H10FN3O2S2 and a molecular weight of 371.42 g/mol. Its IUPAC name is (5E)-5-[[7-(3-amino-4-fluorophenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[7-(3-amino-4-fluorophenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118089632 |
| Molecular Formula | C17H10FN3O2S2 |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | (5E)-5-[[7-(3-amino-4-fluorophenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Nc1cc(-c2cncc3cc(/C=C4/SC(=S)NC4=O)oc23)ccc1F |
| InChI | InChI=1S/C17H10FN3O2S2/c18-12-2-1-8(4-13(12)19)11-7-20-6-9-3-10(23-15(9)11)5-14-16(22)21-17(24)25-14/h1-7H,19H2,(H,21,22,24)/b14-5+ |
| InChIKey | NTCNLNSHTIBQIU-LHHJGKSTSA-N |
| XLogP | 3.70 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|