About 1-butyl-1-methylpyrrolidin-1-ium;sulfanide
1-butyl-1-methylpyrrolidin-1-ium;sulfanide (PubChem CID 118089682) has the molecular formula C9H21NS
and a molecular weight of 175.34 g/mol. Its IUPAC name is 1-butyl-1-methylpyrrolidin-1-ium;sulfanide.
Molecular Properties
| Compound Name | 1-butyl-1-methylpyrrolidin-1-ium;sulfanide |
| PubChem CID | 118089682 |
| Molecular Formula | C9H21NS |
| Molecular Weight | 175.34 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-butyl-1-methylpyrrolidin-1-ium;sulfanide |
| SMILES | CCCC[N+]1(C)CCCC1.[SH-] |
| InChI | InChI=1S/C9H20N.H2S/c1-3-4-7-10(2)8-5-6-9-10;/h3-9H2,1-2H3;1H2/q+1;/p-1 |
| InChIKey | OJANWLBKGUGBDW-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-1-methylpyrrolidin-1-ium;sulfanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1-methylpyrrolidin-1-ium;sulfanide?
The IUPAC name of 1-butyl-1-methylpyrrolidin-1-ium;sulfanide (CID 118089682) is 1-butyl-1-methylpyrrolidin-1-ium;sulfanide.
What is the SMILES notation for 1-butyl-1-methylpyrrolidin-1-ium;sulfanide?
The canonical SMILES for 1-butyl-1-methylpyrrolidin-1-ium;sulfanide is CCCC[N+]1(C)CCCC1.[SH-].
What is the InChIKey of 1-butyl-1-methylpyrrolidin-1-ium;sulfanide?
The InChIKey is OJANWLBKGUGBDW-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H20N.H2S/c1-3-4-7-10(2)8-5-6-9-10;/h3-9H2,1-2H3;1H2/q+1;/p-1.
What are the key properties of 1-butyl-1-methylpyrrolidin-1-ium;sulfanide?
1-butyl-1-methylpyrrolidin-1-ium;sulfanide has a molecular weight of 175.34 g/mol, XLogP of 1.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1-methylpyrrolidin-1-ium;sulfanide is sourced from PubChem (CID 118089682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).