C19H12F3N3O4S — CID 118089768
(5Z)-5-[1-[7-[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]furo[3,2-c]pyridin-2-yl]ethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118089768) has the molecular formula C19H12F3N3O4S and a molecular weight of 435.38 g/mol. Its IUPAC name is (5Z)-5-[1-[7-[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]furo[3,2-c]pyridin-2-yl]ethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[1-[7-[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]furo[3,2-c]pyridin-2-yl]ethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118089768 |
| Molecular Formula | C19H12F3N3O4S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | (5Z)-5-[1-[7-[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]furo[3,2-c]pyridin-2-yl]ethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ncc(-c2cncc3cc(/C(C)=C4\SC(=O)NC4=O)oc23)cc1C(F)(F)F |
| InChI | InChI=1S/C19H12F3N3O4S/c1-8(15-16(26)25-18(27)30-15)13-4-10-5-23-7-11(14(10)29-13)9-3-12(19(20,21)22)17(28-2)24-6-9/h3-7H,1-2H3,(H,25,26,27)/b15-8- |
| InChIKey | WEYUXYIPGRPKEC-NVNXTCNLSA-N |
| XLogP | 4.63 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|