C22H20Cl2F5NO4 — CID 118091020
carbonic acid;(2S,3R)-N-[2-chloro-5-[(2,2-difluorocyclopropyl)methyl]phenyl]-2-(4-chlorophenyl)-4,4,4-trifluoro-3-methylbutanamide (PubChem CID 118091020) has the molecular formula C22H20Cl2F5NO4 and a molecular weight of 528.30 g/mol. Its IUPAC name is carbonic acid;(2S,3R)-N-[2-chloro-5-[(2,2-difluorocyclopropyl)methyl]phenyl]-2-(4-chlorophenyl)-4,4,4-trifluoro-3-methylbutanamide.
| Compound Name | carbonic acid;(2S,3R)-N-[2-chloro-5-[(2,2-difluorocyclopropyl)methyl]phenyl]-2-(4-chlorophenyl)-4,4,4-trifluoro-3-methylbutanamide |
|---|---|
| PubChem CID | 118091020 |
| Molecular Formula | C22H20Cl2F5NO4 |
| Molecular Weight | 528.30 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | carbonic acid;(2S,3R)-N-[2-chloro-5-[(2,2-difluorocyclopropyl)methyl]phenyl]-2-(4-chlorophenyl)-4,4,4-trifluoro-3-methylbutanamide |
| SMILES | C[C@H]([C@H](C(=O)Nc1cc(CC2CC2(F)F)ccc1Cl)c1ccc(Cl)cc1)C(F)(F)F.O=C(O)O |
| InChI | InChI=1S/C21H18Cl2F5NO.CH2O3/c1-11(21(26,27)28)18(13-3-5-15(22)6-4-13)19(30)29-17-9-12(2-7-16(17)23)8-14-10-20(14,24)25;2-1(3)4/h2-7,9,11,14,18H,8,10H2,1H3,(H,29,30);(H2,2,3,4)/t11-,14?,18+;/m1./s1 |
| InChIKey | GYGRVQJRPNYCDI-RTSCGTKQSA-N |
| XLogP | 7.33 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.30 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |