About 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one
5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one (PubChem CID 118091683) has the molecular formula C6H8N4O
and a molecular weight of 152.16 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one.
Analyze 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one?
The IUPAC name of 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one (CID 118091683) is 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one.
What is the SMILES notation for 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one?
The canonical SMILES for 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one is O=c1ncc2c([nH]1)CNCN2.
What is the InChIKey of 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one?
The InChIKey is VDUDRXMNUKAMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O/c11-6-8-2-4-5(10-6)1-7-3-9-4/h2,7,9H,1,3H2,(H,8,10,11).
What are the key properties of 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one?
5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one has a molecular weight of 152.16 g/mol, XLogP of -0.76, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydro-1H-pyrimido[5,4-d]pyrimidin-2-one is sourced from PubChem (CID 118091683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).