C19H26O2Si — CID 11809209
(2R,5Z,9S)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol (PubChem CID 11809209) has the molecular formula C19H26O2Si and a molecular weight of 314.50 g/mol. Its IUPAC name is (2R,5Z,9S)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol.
| Compound Name | (2R,5Z,9S)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol |
|---|---|
| PubChem CID | 11809209 |
| Molecular Formula | C19H26O2Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2R,5Z,9S)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]12C#C/C=C\C#C[C@H](O)C(=CCC1)C2 |
| InChI | InChI=1S/C19H26O2Si/c1-18(2,3)22(4,5)21-19-13-9-7-6-8-12-17(20)16(15-19)11-10-14-19/h6-7,11,17,20H,10,14-15H2,1-5H3/b7-6-/t17-,19-/m0/s1 |
| InChIKey | CMNRLVHYAGPQHN-OIIZEAPSSA-N |
| XLogP | 3.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|