About [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride
[4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride (PubChem CID 118092907) has the molecular formula C12H22ClN2O3P
and a molecular weight of 308.75 g/mol. Its IUPAC name is [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride.
Molecular Properties
| Compound Name | [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride |
| PubChem CID | 118092907 |
| Molecular Formula | C12H22ClN2O3P |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride |
| SMILES | CCc1cc(P(=O)(O)O)c(CNC)c(CC)c1N.Cl |
| InChI | InChI=1S/C12H21N2O3P.ClH/c1-4-8-6-11(18(15,16)17)10(7-14-3)9(5-2)12(8)13;/h6,14H,4-5,7,13H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | XBFBITPDFVMMBX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride?
The IUPAC name of [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride (CID 118092907) is [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride.
What is the SMILES notation for [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride?
The canonical SMILES for [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride is CCc1cc(P(=O)(O)O)c(CNC)c(CC)c1N.Cl.
What is the InChIKey of [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride?
The InChIKey is XBFBITPDFVMMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N2O3P.ClH/c1-4-8-6-11(18(15,16)17)10(7-14-3)9(5-2)12(8)13;/h6,14H,4-5,7,13H2,1-3H3,(H2,15,16,17);1H.
What are the key properties of [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride?
[4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride has a molecular weight of 308.75 g/mol, XLogP of 1.34, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-3,5-diethyl-2-(methylaminomethyl)phenyl]phosphonic acid;hydrochloride is sourced from PubChem (CID 118092907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).