C20H30O3 — CID 11809307
(4'bS,8'aR,10'aR)-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-3,5,6,8a,9,10-hexahydro-2H-phenanthrene]-1'-one (PubChem CID 11809307) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4'bS,8'aR,10'aR)-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-3,5,6,8a,9,10-hexahydro-2H-phenanthrene]-1'-one.
| Compound Name | (4'bS,8'aR,10'aR)-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-3,5,6,8a,9,10-hexahydro-2H-phenanthrene]-1'-one |
|---|---|
| PubChem CID | 11809307 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4'bS,8'aR,10'aR)-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-3,5,6,8a,9,10-hexahydro-2H-phenanthrene]-1'-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]3(C)C(=O)CCC=C3[C@@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C20H30O3/c1-17(2)14-8-9-19(4)15(6-5-7-16(19)21)18(14,3)10-11-20(17)22-12-13-23-20/h6,14H,5,7-13H2,1-4H3/t14-,18-,19+/m0/s1 |
| InChIKey | CSQNVMGBRCTMRN-ZOCIIQOWSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|