C23H29N5O4 — CID 118093299
1-[2-[(1R,2S,5S)-2-[(3,3-dimethylcyclohexyl)carbamoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]pyrazolo[5,4-c]pyridine-3-carboxylic acid (PubChem CID 118093299) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-[2-[(1R,2S,5S)-2-[(3,3-dimethylcyclohexyl)carbamoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]pyrazolo[5,4-c]pyridine-3-carboxylic acid.
| Compound Name | 1-[2-[(1R,2S,5S)-2-[(3,3-dimethylcyclohexyl)carbamoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]pyrazolo[5,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118093299 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 1-[2-[(1R,2S,5S)-2-[(3,3-dimethylcyclohexyl)carbamoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]pyrazolo[5,4-c]pyridine-3-carboxylic acid |
| SMILES | CC1(C)CCCC(NC(=O)[C@@H]2[C@@H]3C[C@@H]3CN2C(=O)Cn2nc(C(=O)O)c3ccncc32)C1 |
| InChI | InChI=1S/C23H29N5O4/c1-23(2)6-3-4-14(9-23)25-21(30)20-16-8-13(16)11-27(20)18(29)12-28-17-10-24-7-5-15(17)19(26-28)22(31)32/h5,7,10,13-14,16,20H,3-4,6,8-9,11-12H2,1-2H3,(H,25,30)(H,31,32)/t13-,14?,16-,20+/m1/s1 |
| InChIKey | OGIIMJRSLMPSJC-BDJAEKLVSA-N |
| XLogP | 2.06 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |