About 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole
6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole (PubChem CID 118093631) has the molecular formula C18H15BrF2N2O2
and a molecular weight of 409.23 g/mol. Its IUPAC name is 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole.
Molecular Properties
| Compound Name | 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole |
| PubChem CID | 118093631 |
| Molecular Formula | C18H15BrF2N2O2 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole |
| SMILES | Fc1ccc(Oc2cc3ncn(C4CCCCO4)c3cc2Br)c(F)c1 |
| InChI | InChI=1S/C18H15BrF2N2O2/c19-12-8-15-14(22-10-23(15)18-3-1-2-6-24-18)9-17(12)25-16-5-4-11(20)7-13(16)21/h4-5,7-10,18H,1-3,6H2 |
| InChIKey | DIFFSLGPROMNHN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole?
The IUPAC name of 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole (CID 118093631) is 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole.
What is the SMILES notation for 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole?
The canonical SMILES for 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole is Fc1ccc(Oc2cc3ncn(C4CCCCO4)c3cc2Br)c(F)c1.
What is the InChIKey of 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole?
The InChIKey is DIFFSLGPROMNHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrF2N2O2/c19-12-8-15-14(22-10-23(15)18-3-1-2-6-24-18)9-17(12)25-16-5-4-11(20)7-13(16)21/h4-5,7-10,18H,1-3,6H2.
What are the key properties of 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole?
6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole has a molecular weight of 409.23 g/mol, XLogP of 5.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-(2,4-difluorophenoxy)-1-(oxan-2-yl)benzimidazole is sourced from PubChem (CID 118093631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).