C19H28O4 — CID 11809375
[(2E,4E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpenta-2,4-dienyl] acetate (PubChem CID 11809375) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is [(2E,4E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpenta-2,4-dienyl] acetate.
| Compound Name | [(2E,4E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpenta-2,4-dienyl] acetate |
|---|---|
| PubChem CID | 11809375 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [(2E,4E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpenta-2,4-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(C)/C=C/C1=C(C)CC(OC(C)=O)CC1(C)C |
| InChI | InChI=1S/C19H28O4/c1-13(9-10-22-15(3)20)7-8-18-14(2)11-17(23-16(4)21)12-19(18,5)6/h7-9,17H,10-12H2,1-6H3/b8-7+,13-9+ |
| InChIKey | YRXOFFGSFUDICN-NJHPPEEMSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|