About 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene
2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene (PubChem CID 11809378) has the molecular formula C22H24O2
and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene.
Molecular Properties
| Compound Name | 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene |
| PubChem CID | 11809378 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene |
| SMILES | C=CCOc1ccc(OCC=C)c(/C=C/c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C22H24O2/c1-5-13-23-21-11-12-22(24-14-6-2)20(16-21)10-9-19-15-17(3)7-8-18(19)4/h5-12,15-16H,1-2,13-14H2,3-4H3/b10-9+ |
| InChIKey | YCTXWNVJSKJJKW-MDZDMXLPSA-N |
| XLogP | 5.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene?
The IUPAC name of 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene (CID 11809378) is 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene.
What is the SMILES notation for 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene?
The canonical SMILES for 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene is C=CCOc1ccc(OCC=C)c(/C=C/c2cc(C)ccc2C)c1.
What is the InChIKey of 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene?
The InChIKey is YCTXWNVJSKJJKW-MDZDMXLPSA-N. The full InChI is InChI=1S/C22H24O2/c1-5-13-23-21-11-12-22(24-14-6-2)20(16-21)10-9-19-15-17(3)7-8-18(19)4/h5-12,15-16H,1-2,13-14H2,3-4H3/b10-9+.
What are the key properties of 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene?
2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene has a molecular weight of 320.43 g/mol, XLogP of 5.60, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-[2,5-bis(prop-2-enoxy)phenyl]ethenyl]-1,4-dimethylbenzene is sourced from PubChem (CID 11809378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).