About methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate
methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate (PubChem CID 11809381) has the molecular formula C10H8O4S4
and a molecular weight of 320.44 g/mol. Its IUPAC name is methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate.
Molecular Properties
| Compound Name | methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate |
| PubChem CID | 11809381 |
| Molecular Formula | C10H8O4S4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate |
| SMILES | COC(=O)C1=CS/C(=C2/SC=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C10H8O4S4/c1-13-7(11)5-3-15-9(17-5)10-16-4-6(18-10)8(12)14-2/h3-4H,1-2H3/b10-9+ |
| InChIKey | YHUDTMKASBQNLY-MDZDMXLPSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate?
The IUPAC name of methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate (CID 11809381) is methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate.
What is the SMILES notation for methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate?
The canonical SMILES for methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate is COC(=O)C1=CS/C(=C2/SC=C(C(=O)OC)S2)S1.
What is the InChIKey of methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate?
The InChIKey is YHUDTMKASBQNLY-MDZDMXLPSA-N. The full InChI is InChI=1S/C10H8O4S4/c1-13-7(11)5-3-15-9(17-5)10-16-4-6(18-10)8(12)14-2/h3-4H,1-2H3/b10-9+.
What are the key properties of methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate?
methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate has a molecular weight of 320.44 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-2-(4-methoxycarbonyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate is sourced from PubChem (CID 11809381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).