C20H38OSi — CID 11809460
1-[(2R,3aS,6aS)-6a-methyl-2-tri(propan-2-yl)silyl-1,2,3,4,5,6-hexahydropentalen-3a-yl]ethanone (PubChem CID 11809460) has the molecular formula C20H38OSi and a molecular weight of 322.61 g/mol. Its IUPAC name is 1-[(2R,3aS,6aS)-6a-methyl-2-tri(propan-2-yl)silyl-1,2,3,4,5,6-hexahydropentalen-3a-yl]ethanone.
| Compound Name | 1-[(2R,3aS,6aS)-6a-methyl-2-tri(propan-2-yl)silyl-1,2,3,4,5,6-hexahydropentalen-3a-yl]ethanone |
|---|---|
| PubChem CID | 11809460 |
| Molecular Formula | C20H38OSi |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1-[(2R,3aS,6aS)-6a-methyl-2-tri(propan-2-yl)silyl-1,2,3,4,5,6-hexahydropentalen-3a-yl]ethanone |
| SMILES | CC(=O)[C@]12CCC[C@@]1(C)C[C@@H]([Si](C(C)C)(C(C)C)C(C)C)C2 |
| InChI | InChI=1S/C20H38OSi/c1-14(2)22(15(3)4,16(5)6)18-12-19(8)10-9-11-20(19,13-18)17(7)21/h14-16,18H,9-13H2,1-8H3/t18-,19+,20-/m1/s1 |
| InChIKey | YALYZSNYTWDYIT-HSALFYBXSA-N |
| XLogP | 6.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|