C13H16FeO6 — CID 11809485
carbon monoxide;(3S,6E,8E)-1,3-dihydroxydeca-6,8-dien-5-one;iron (PubChem CID 11809485) has the molecular formula C13H16FeO6 and a molecular weight of 324.11 g/mol. Its IUPAC name is carbon monoxide;(3S,6E,8E)-1,3-dihydroxydeca-6,8-dien-5-one;iron.
| Compound Name | carbon monoxide;(3S,6E,8E)-1,3-dihydroxydeca-6,8-dien-5-one;iron |
|---|---|
| PubChem CID | 11809485 |
| Molecular Formula | C13H16FeO6 |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | carbon monoxide;(3S,6E,8E)-1,3-dihydroxydeca-6,8-dien-5-one;iron |
| SMILES | C/C=C/C=C/C(=O)C[C@@H](O)CCO.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C10H16O3.3CO.Fe/c1-2-3-4-5-9(12)8-10(13)6-7-11;3*1-2;/h2-5,10-11,13H,6-8H2,1H3;;;;/b3-2+,5-4+;;;;/t10-;;;;/m0..../s1 |
| InChIKey | QAVLDQKYAMUJGK-DIFLVFBISA-N |
| XLogP | 0.71 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|