C14H25BO6Si — CID 11809601
diethyl (4R,5R)-2-[(E)-3-trimethylsilylprop-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate (PubChem CID 11809601) has the molecular formula C14H25BO6Si and a molecular weight of 328.25 g/mol. Its IUPAC name is diethyl (4R,5R)-2-[(E)-3-trimethylsilylprop-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate.
| Compound Name | diethyl (4R,5R)-2-[(E)-3-trimethylsilylprop-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11809601 |
| Molecular Formula | C14H25BO6Si |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | diethyl (4R,5R)-2-[(E)-3-trimethylsilylprop-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1OB(C/C=C/[Si](C)(C)C)O[C@H]1C(=O)OCC |
| InChI | InChI=1S/C14H25BO6Si/c1-6-18-13(16)11-12(14(17)19-7-2)21-15(20-11)9-8-10-22(3,4)5/h8,10-12H,6-7,9H2,1-5H3/b10-8+/t11-,12-/m1/s1 |
| InChIKey | NPNDRMDHTCNDOM-BXAYLQTHSA-N |
| XLogP | 1.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|