C17H32O4Si — CID 11809622
(E)-3-[(2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]but-2-enal (PubChem CID 11809622) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is (E)-3-[(2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]but-2-enal.
| Compound Name | (E)-3-[(2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]but-2-enal |
|---|---|
| PubChem CID | 11809622 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (E)-3-[(2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]but-2-enal |
| SMILES | CO[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](/C(C)=C/C=O)OC[C@@H]1C |
| InChI | InChI=1S/C17H32O4Si/c1-12(9-10-18)15-16(14(19-6)13(2)11-20-15)21-22(7,8)17(3,4)5/h9-10,13-16H,11H2,1-8H3/b12-9+/t13-,14-,15-,16+/m0/s1 |
| InChIKey | NVELWYUFTPDHBU-YOMBRXGLSA-N |
| XLogP | 3.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|