About [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate
[4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate (PubChem CID 11809733) has the molecular formula C20H16N2O3
and a molecular weight of 332.36 g/mol. Its IUPAC name is [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate |
| PubChem CID | 11809733 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C2\CCn3c2nc2ccccc2c3=O)cc1 |
| InChI | InChI=1S/C20H16N2O3/c1-13(23)25-16-8-6-14(7-9-16)12-15-10-11-22-19(15)21-18-5-3-2-4-17(18)20(22)24/h2-9,12H,10-11H2,1H3/b15-12+ |
| InChIKey | UQDCVJPTNFXYOC-NTCAYCPXSA-N |
| XLogP | 3.27 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate?
The IUPAC name of [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate (CID 11809733) is [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate.
What is the SMILES notation for [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate?
The canonical SMILES for [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate is CC(=O)Oc1ccc(/C=C2\CCn3c2nc2ccccc2c3=O)cc1.
What is the InChIKey of [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate?
The InChIKey is UQDCVJPTNFXYOC-NTCAYCPXSA-N. The full InChI is InChI=1S/C20H16N2O3/c1-13(23)25-16-8-6-14(7-9-16)12-15-10-11-22-19(15)21-18-5-3-2-4-17(18)20(22)24/h2-9,12H,10-11H2,1H3/b15-12+.
What are the key properties of [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate?
[4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate has a molecular weight of 332.36 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-(9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]phenyl] acetate is sourced from PubChem (CID 11809733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).