C16H32OS2Si — CID 11809749
tert-butyl-[(Z,4R)-4-(1,3-dithian-2-yl)hex-2-enoxy]-dimethylsilane (PubChem CID 11809749) has the molecular formula C16H32OS2Si and a molecular weight of 332.65 g/mol. Its IUPAC name is tert-butyl-[(Z,4R)-4-(1,3-dithian-2-yl)hex-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,4R)-4-(1,3-dithian-2-yl)hex-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11809749 |
| Molecular Formula | C16H32OS2Si |
| Molecular Weight | 332.65 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl-[(Z,4R)-4-(1,3-dithian-2-yl)hex-2-enoxy]-dimethylsilane |
| SMILES | CC[C@H](/C=C\CO[Si](C)(C)C(C)(C)C)C1SCCCS1 |
| InChI | InChI=1S/C16H32OS2Si/c1-7-14(15-18-12-9-13-19-15)10-8-11-17-20(5,6)16(2,3)4/h8,10,14-15H,7,9,11-13H2,1-6H3/b10-8-/t14-/m1/s1 |
| InChIKey | GBKHLVKPZHXSJX-QQBNSCQMSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|