C33H46N4O5 — CID 118097839
(4E)-4-[4-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-(2-methoxyethoxyimino)butanoic acid (PubChem CID 118097839) has the molecular formula C33H46N4O5 and a molecular weight of 578.75 g/mol. Its IUPAC name is (4E)-4-[4-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-(2-methoxyethoxyimino)butanoic acid.
| Compound Name | (4E)-4-[4-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-(2-methoxyethoxyimino)butanoic acid |
|---|---|
| PubChem CID | 118097839 |
| Molecular Formula | C33H46N4O5 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | (4E)-4-[4-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-(2-methoxyethoxyimino)butanoic acid |
| SMILES | COCCO/N=C(\CCC(=O)O)c1nc2ccccc2n(C2C[C@H]3CCC[C@@H](C2)N3C2CC3CCCCC(C3)C2)c1=O |
| InChI | InChI=1S/C33H46N4O5/c1-41-15-16-42-35-29(13-14-31(38)39)32-33(40)37(30-12-5-4-11-28(30)34-32)27-20-24-9-6-10-25(21-27)36(24)26-18-22-7-2-3-8-23(17-22)19-26/h4-5,11-12,22-27H,2-3,6-10,13-21H2,1H3,(H,38,39)/b35-29+/t22?,23?,24-,25+,26?,27? |
| InChIKey | HFAQPJYDXADZQA-MBOZMBNDSA-N |
| XLogP | 5.55 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|