C14H23FO6Si — CID 11809791
diethyl 3-fluoro-2-trimethylsilyloxy-2,5-dihydropyran-6,6-dicarboxylate (PubChem CID 11809791) has the molecular formula C14H23FO6Si and a molecular weight of 334.42 g/mol. Its IUPAC name is diethyl 3-fluoro-2-trimethylsilyloxy-2,5-dihydropyran-6,6-dicarboxylate.
| Compound Name | diethyl 3-fluoro-2-trimethylsilyloxy-2,5-dihydropyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 11809791 |
| Molecular Formula | C14H23FO6Si |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | diethyl 3-fluoro-2-trimethylsilyloxy-2,5-dihydropyran-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC=C(F)C(O[Si](C)(C)C)O1 |
| InChI | InChI=1S/C14H23FO6Si/c1-6-18-12(16)14(13(17)19-7-2)9-8-10(15)11(20-14)21-22(3,4)5/h8,11H,6-7,9H2,1-5H3 |
| InChIKey | ZDHAHRZPPGCVEY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|