C6H6F8OS — CID 118098168
1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluorobutoxy)ethanethiol (PubChem CID 118098168) has the molecular formula C6H6F8OS and a molecular weight of 278.16 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluorobutoxy)ethanethiol.
| Compound Name | 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluorobutoxy)ethanethiol |
|---|---|
| PubChem CID | 118098168 |
| Molecular Formula | C6H6F8OS |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluorobutoxy)ethanethiol |
| SMILES | CCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)S |
| InChI | InChI=1S/C6H6F8OS/c1-2-3(7,8)4(9,10)15-5(11,12)6(13,14)16/h16H,2H2,1H3 |
| InChIKey | FDUUIVFYNNNSHW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|