C20H20N2O3 — CID 11809836
(1R,2S,6R,9R)-4-benzyl-9-phenyl-3,10-dioxa-4,8-diazatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 11809836) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (1R,2S,6R,9R)-4-benzyl-9-phenyl-3,10-dioxa-4,8-diazatricyclo[6.3.0.02,6]undecan-7-one.
| Compound Name | (1R,2S,6R,9R)-4-benzyl-9-phenyl-3,10-dioxa-4,8-diazatricyclo[6.3.0.02,6]undecan-7-one |
|---|---|
| PubChem CID | 11809836 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (1R,2S,6R,9R)-4-benzyl-9-phenyl-3,10-dioxa-4,8-diazatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | O=C1[C@@H]2CN(Cc3ccccc3)O[C@@H]2[C@H]2CO[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C20H20N2O3/c23-19-16-12-21(11-14-7-3-1-4-8-14)25-18(16)17-13-24-20(22(17)19)15-9-5-2-6-10-15/h1-10,16-18,20H,11-13H2/t16-,17-,18+,20-/m1/s1 |
| InChIKey | AQNRJYGDPZSRDY-FTEYMNFISA-N |
| XLogP | 2.36 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |