C14H18F6N4O2 — CID 118098577
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate (PubChem CID 118098577) has the molecular formula C14H18F6N4O2 and a molecular weight of 388.31 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118098577 |
| Molecular Formula | C14H18F6N4O2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate |
| SMILES | Cc1nn(C)cc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H18F6N4O2/c1-9-10(7-22(2)21-9)8-23-3-5-24(6-4-23)12(25)26-11(13(15,16)17)14(18,19)20/h7,11H,3-6,8H2,1-2H3 |
| InChIKey | MFMKZRLCDKBYLU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |