C21H36O3 — CID 11809858
ethyl (6E,10E)-5-hydroxy-7,11,15-trimethylhexadeca-6,10,14-trienoate (PubChem CID 11809858) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is ethyl (6E,10E)-5-hydroxy-7,11,15-trimethylhexadeca-6,10,14-trienoate.
| Compound Name | ethyl (6E,10E)-5-hydroxy-7,11,15-trimethylhexadeca-6,10,14-trienoate |
|---|---|
| PubChem CID | 11809858 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | ethyl (6E,10E)-5-hydroxy-7,11,15-trimethylhexadeca-6,10,14-trienoate |
| SMILES | CCOC(=O)CCCC(O)/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H36O3/c1-6-24-21(23)15-9-14-20(22)16-19(5)13-8-12-18(4)11-7-10-17(2)3/h10,12,16,20,22H,6-9,11,13-15H2,1-5H3/b18-12+,19-16+ |
| InChIKey | FIRQHTHHWQNUJJ-WBLKYFKXSA-N |
| XLogP | 5.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|