C25H23F6NO6 — CID 118098581
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[1,3-benzodioxol-5-yl-(1,3-dihydro-2-benzofuran-5-yl)-hydroxymethyl]piperidine-1-carboxylate (PubChem CID 118098581) has the molecular formula C25H23F6NO6 and a molecular weight of 547.45 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[1,3-benzodioxol-5-yl-(1,3-dihydro-2-benzofuran-5-yl)-hydroxymethyl]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[1,3-benzodioxol-5-yl-(1,3-dihydro-2-benzofuran-5-yl)-hydroxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118098581 |
| Molecular Formula | C25H23F6NO6 |
| Molecular Weight | 547.45 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[1,3-benzodioxol-5-yl-(1,3-dihydro-2-benzofuran-5-yl)-hydroxymethyl]piperidine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC(C(O)(c2ccc3c(c2)COC3)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C25H23F6NO6/c26-24(27,28)21(25(29,30)31)38-22(33)32-7-5-16(6-8-32)23(34,17-2-1-14-11-35-12-15(14)9-17)18-3-4-19-20(10-18)37-13-36-19/h1-4,9-10,16,21,34H,5-8,11-13H2 |
| InChIKey | BLBLIVQDXZDYIZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |