C34H38FN5O5 — CID 118098659
(2R,15R)-2-[(1-aminoisoquinolin-6-yl)amino]-8-fluoro-7-(3-methoxypropoxy)-4,15,17-trimethyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaene-3,12-dione (PubChem CID 118098659) has the molecular formula C34H38FN5O5 and a molecular weight of 615.71 g/mol. Its IUPAC name is (2R,15R)-2-[(1-aminoisoquinolin-6-yl)amino]-8-fluoro-7-(3-methoxypropoxy)-4,15,17-trimethyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaene-3,12-dione.
| Compound Name | (2R,15R)-2-[(1-aminoisoquinolin-6-yl)amino]-8-fluoro-7-(3-methoxypropoxy)-4,15,17-trimethyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaene-3,12-dione |
|---|---|
| PubChem CID | 118098659 |
| Molecular Formula | C34H38FN5O5 |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | (2R,15R)-2-[(1-aminoisoquinolin-6-yl)amino]-8-fluoro-7-(3-methoxypropoxy)-4,15,17-trimethyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaene-3,12-dione |
| SMILES | COCCCOc1c(F)cc2cc1CN(C)C(=O)[C@H](Nc1ccc3c(N)nccc3c1)c1ccc(c(C)c1)[C@@H](C)COC(=O)N2 |
| InChI | InChI=1S/C34H38FN5O5/c1-20-14-23-6-8-27(20)21(2)19-45-34(42)39-26-16-24(31(29(35)17-26)44-13-5-12-43-4)18-40(3)33(41)30(23)38-25-7-9-28-22(15-25)10-11-37-32(28)36/h6-11,14-17,21,30,38H,5,12-13,18-19H2,1-4H3,(H2,36,37)(H,39,42)/t21-,30+/m0/s1 |
| InChIKey | AWEFVBXUIWHVGW-URAOTHONSA-N |
| XLogP | 6.16 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|