About 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one
3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one (PubChem CID 118099334) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one.
Molecular Properties
| Compound Name | 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one |
| PubChem CID | 118099334 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one |
| SMILES | COCC1C(=O)C(COC)C(OC)C1OC |
| InChI | InChI=1S/C11H20O5/c1-13-5-7-9(12)8(6-14-2)11(16-4)10(7)15-3/h7-8,10-11H,5-6H2,1-4H3 |
| InChIKey | MUCWUOKYTDXGSF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one?
The IUPAC name of 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one (CID 118099334) is 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one.
What is the SMILES notation for 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one?
The canonical SMILES for 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one is COCC1C(=O)C(COC)C(OC)C1OC.
What is the InChIKey of 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one?
The InChIKey is MUCWUOKYTDXGSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5/c1-13-5-7-9(12)8(6-14-2)11(16-4)10(7)15-3/h7-8,10-11H,5-6H2,1-4H3.
What are the key properties of 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one?
3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one has a molecular weight of 232.28 g/mol, XLogP of 0.12, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxy-2,5-bis(methoxymethyl)cyclopentan-1-one is sourced from PubChem (CID 118099334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).