C8H5Cl5 — CID 11810
1,2,3,4,5-pentachloro-6-ethylbenzene (PubChem CID 11810) has the molecular formula C8H5Cl5 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-ethylbenzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-ethylbenzene |
|---|---|
| PubChem CID | 11810 |
| Molecular Formula | C8H5Cl5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 275.88 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-ethylbenzene |
| SMILES | CCc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H5Cl5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H2,1H3 |
| InChIKey | JBLPFPMLHWDSFR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|