About 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine
2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine (PubChem CID 118100346) has the molecular formula C25H19BrN2
and a molecular weight of 427.35 g/mol. Its IUPAC name is 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine |
| PubChem CID | 118100346 |
| Molecular Formula | C25H19BrN2 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine |
| SMILES | CC1(C)c2ccccc2-c2nc(-c3cccc(Br)c3)nc(-c3ccccc3)c21 |
| InChI | InChI=1S/C25H19BrN2/c1-25(2)20-14-7-6-13-19(20)23-21(25)22(16-9-4-3-5-10-16)27-24(28-23)17-11-8-12-18(26)15-17/h3-15H,1-2H3 |
| InChIKey | XXBXNMDVLDNQTD-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine?
The IUPAC name of 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine (CID 118100346) is 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine.
What is the SMILES notation for 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine?
The canonical SMILES for 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine is CC1(C)c2ccccc2-c2nc(-c3cccc(Br)c3)nc(-c3ccccc3)c21.
What is the InChIKey of 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine?
The InChIKey is XXBXNMDVLDNQTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19BrN2/c1-25(2)20-14-7-6-13-19(20)23-21(25)22(16-9-4-3-5-10-16)27-24(28-23)17-11-8-12-18(26)15-17/h3-15H,1-2H3.
What are the key properties of 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine?
2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine has a molecular weight of 427.35 g/mol, XLogP of 6.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)-5,5-dimethyl-4-phenylindeno[1,2-d]pyrimidine is sourced from PubChem (CID 118100346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).