C12H14O5P+ — CID 118100619
[(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy-oxo-phenylphosphanium (PubChem CID 118100619) has the molecular formula C12H14O5P+ and a molecular weight of 269.21 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy-oxo-phenylphosphanium.
| Compound Name | [(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy-oxo-phenylphosphanium |
|---|---|
| PubChem CID | 118100619 |
| Molecular Formula | C12H14O5P+ |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy-oxo-phenylphosphanium |
| SMILES | O=[P+](O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O)c1ccccc1 |
| InChI | InChI=1S/C12H14O5P/c13-9-6-15-12-10(7-16-11(9)12)17-18(14)8-4-2-1-3-5-8/h1-5,9-13H,6-7H2/q+1/t9-,10+,11+,12+/m0/s1 |
| InChIKey | YIVDXZJHZYHIBN-IRCOFANPSA-N |
| XLogP | 0.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|