C21H28O2S — CID 11810089
methyl (E)-2-methyl-5-[(1S,6R)-6-(4-methylphenyl)sulfanyl-1-bicyclo[4.1.0]heptanyl]pent-2-enoate (PubChem CID 11810089) has the molecular formula C21H28O2S and a molecular weight of 344.52 g/mol. Its IUPAC name is methyl (E)-2-methyl-5-[(1S,6R)-6-(4-methylphenyl)sulfanyl-1-bicyclo[4.1.0]heptanyl]pent-2-enoate.
| Compound Name | methyl (E)-2-methyl-5-[(1S,6R)-6-(4-methylphenyl)sulfanyl-1-bicyclo[4.1.0]heptanyl]pent-2-enoate |
|---|---|
| PubChem CID | 11810089 |
| Molecular Formula | C21H28O2S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl (E)-2-methyl-5-[(1S,6R)-6-(4-methylphenyl)sulfanyl-1-bicyclo[4.1.0]heptanyl]pent-2-enoate |
| SMILES | COC(=O)/C(C)=C/CC[C@]12CCCC[C@@]1(Sc1ccc(C)cc1)C2 |
| InChI | InChI=1S/C21H28O2S/c1-16-8-10-18(11-9-16)24-21-14-5-4-12-20(21,15-21)13-6-7-17(2)19(22)23-3/h7-11H,4-6,12-15H2,1-3H3/b17-7+/t20-,21+/m0/s1 |
| InChIKey | LMPGXCMDHDRQCX-ULDYEVIBSA-N |
| XLogP | 5.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|