C26H52N2O2 — CID 118101175
N-[2,4-dimethyl-4-(2,2,4,4-tetramethylpentanoylamino)hexan-2-yl]-2,2,4,4-tetramethylpentanamide (PubChem CID 118101175) has the molecular formula C26H52N2O2 and a molecular weight of 424.71 g/mol. Its IUPAC name is N-[2,4-dimethyl-4-(2,2,4,4-tetramethylpentanoylamino)hexan-2-yl]-2,2,4,4-tetramethylpentanamide.
| Compound Name | N-[2,4-dimethyl-4-(2,2,4,4-tetramethylpentanoylamino)hexan-2-yl]-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 118101175 |
| Molecular Formula | C26H52N2O2 |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.40 |
| IUPAC Name | N-[2,4-dimethyl-4-(2,2,4,4-tetramethylpentanoylamino)hexan-2-yl]-2,2,4,4-tetramethylpentanamide |
| SMILES | CCC(C)(CC(C)(C)NC(=O)C(C)(C)CC(C)(C)C)NC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C26H52N2O2/c1-15-26(14,28-20(30)24(10,11)17-22(5,6)7)18-25(12,13)27-19(29)23(8,9)16-21(2,3)4/h15-18H2,1-14H3,(H,27,29)(H,28,30) |
| InChIKey | BQXAATXQSSQLIP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |