C18H21NO6 — CID 11810162
methyl 2-[(6R,8R)-5,10-dimethoxy-6-methyl-4-oxo-1,6,8,9-tetrahydropyrano[3,4-g]quinolin-8-yl]acetate (PubChem CID 11810162) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl 2-[(6R,8R)-5,10-dimethoxy-6-methyl-4-oxo-1,6,8,9-tetrahydropyrano[3,4-g]quinolin-8-yl]acetate.
| Compound Name | methyl 2-[(6R,8R)-5,10-dimethoxy-6-methyl-4-oxo-1,6,8,9-tetrahydropyrano[3,4-g]quinolin-8-yl]acetate |
|---|---|
| PubChem CID | 11810162 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | methyl 2-[(6R,8R)-5,10-dimethoxy-6-methyl-4-oxo-1,6,8,9-tetrahydropyrano[3,4-g]quinolin-8-yl]acetate |
| SMILES | COC(=O)C[C@H]1Cc2c(c(OC)c3c(=O)cc[nH]c3c2OC)[C@@H](C)O1 |
| InChI | InChI=1S/C18H21NO6/c1-9-14-11(7-10(25-9)8-13(21)22-2)17(23-3)16-15(18(14)24-4)12(20)5-6-19-16/h5-6,9-10H,7-8H2,1-4H3,(H,19,20)/t9-,10-/m1/s1 |
| InChIKey | KDIQGFHOYPGEOQ-NXEZZACHSA-N |
| XLogP | 2.11 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |