C12H20N2 — CID 118102414
(2Z,4E)-5-(pyrrolidin-1-ylmethyl)hepta-2,4,6-trien-2-amine (PubChem CID 118102414) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (2Z,4E)-5-(pyrrolidin-1-ylmethyl)hepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4E)-5-(pyrrolidin-1-ylmethyl)hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 118102414 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (2Z,4E)-5-(pyrrolidin-1-ylmethyl)hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C=C(\C)N)CN1CCCC1 |
| InChI | InChI=1S/C12H20N2/c1-3-12(7-6-11(2)13)10-14-8-4-5-9-14/h3,6-7H,1,4-5,8-10,13H2,2H3/b11-6-,12-7+ |
| InChIKey | LTYGSAQPXWEDRW-TWTKIJFOSA-N |
| XLogP | 2.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|