About N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide
N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide (PubChem CID 118102575) has the molecular formula C9H16F2N2O3S
and a molecular weight of 270.30 g/mol. Its IUPAC name is N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide.
Molecular Properties
| Compound Name | N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide |
| PubChem CID | 118102575 |
| Molecular Formula | C9H16F2N2O3S |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide |
| SMILES | CCS(=O)(=O)CCC(=O)NC1CNCC1(F)F |
| InChI | InChI=1S/C9H16F2N2O3S/c1-2-17(15,16)4-3-8(14)13-7-5-12-6-9(7,10)11/h7,12H,2-6H2,1H3,(H,13,14) |
| InChIKey | JTGWIHPFPBRTDF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide?
The IUPAC name of N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide (CID 118102575) is N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide.
What is the SMILES notation for N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide?
The canonical SMILES for N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide is CCS(=O)(=O)CCC(=O)NC1CNCC1(F)F.
What is the InChIKey of N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide?
The InChIKey is JTGWIHPFPBRTDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2O3S/c1-2-17(15,16)4-3-8(14)13-7-5-12-6-9(7,10)11/h7,12H,2-6H2,1H3,(H,13,14).
What are the key properties of N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide?
N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide has a molecular weight of 270.30 g/mol, XLogP of -0.47, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluoropyrrolidin-3-yl)-3-ethylsulfonylpropanamide is sourced from PubChem (CID 118102575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).